CAS 272-97-9
:5-Azabenzimidazole
Description:
5-Azabenzimidazole is a heterocyclic organic compound characterized by its fused ring structure, which includes both a benzene and an imidazole ring. The presence of a nitrogen atom in the benzene ring distinguishes it as an azabenzimidazole. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents. It is known for its potential biological activity, including antimicrobial and anticancer properties, making it of interest in pharmaceutical research. The molecular structure contributes to its ability to interact with biological targets, such as enzymes and receptors. Additionally, 5-Azabenzimidazole can participate in various chemical reactions, including nucleophilic substitutions and cyclization processes, which are valuable in synthetic organic chemistry. Its derivatives may also exhibit enhanced pharmacological properties, further expanding its utility in medicinal chemistry. Overall, 5-Azabenzimidazole serves as a significant scaffold in drug development and research due to its unique structural features and biological relevance.
Formula:C6H5N3
InChI:InChI=1/C6H5N3/c1-2-7-3-6-5(1)8-4-9-6/h1-4H,(H,8,9)
SMILES:c1cncc2c1nc[nH]2
Synonyms:- 1H-Imidazo[4,5-c]pyridine
- 3H-imidazo[4,5-c]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Azabenzimidazole, 98%
CAS:5-Azabenzimidazole is used as Pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference hasFormula:C6H5N3Purity:98%Color and Shape:White to cream to pale yellow to gray, Crystals or powder or crystalline powder or lumps or fused solidMolecular weight:119.131H-Imidazo[4,5-c]pyridine
CAS:1H-Imidazo[4,5-c]pyridineFormula:C6H5N3Purity:98%Color and Shape: white solidMolecular weight:119.12g/mol



