CymitQuimica logo

CAS 27202-71-7

:

2-Azabicyclo[3.1.0]hexane

Description:
2-Azabicyclo[3.1.0]hexane is a bicyclic organic compound characterized by its unique structure, which features a nitrogen atom incorporated into a bicyclic framework. This compound consists of a six-membered ring with a nitrogen atom replacing one of the carbon atoms, resulting in a distinctive bicyclic arrangement. It is a colorless to pale yellow liquid at room temperature and is known for its basicity due to the presence of the nitrogen atom, which can participate in protonation reactions. The compound exhibits moderate solubility in polar solvents and is relatively stable under standard conditions. Its structural features contribute to its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, 2-Azabicyclo[3.1.0]hexane can serve as a building block for more complex molecules, making it of interest in the field of chemical research. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H9N
InChI:InChI=1S/C5H9N/c1-2-6-5-3-4(1)5/h4-6H,1-3H2
InChI key:InChIKey=WSSDGZWSPMAECX-UHFFFAOYSA-N
SMILES:C12C(C1)NCC2
Synonyms:
  • 2-Azabicyclo[3.1.0]hexane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.