CAS 27220-57-1
:Antimycin A2
Description:
Antimycin A2 is a natural antibiotic compound that belongs to the class of antimycin antibiotics, which are produced by certain species of Streptomyces. It is primarily known for its role as a potent inhibitor of the mitochondrial electron transport chain, specifically targeting complex III (cytochrome bc1 complex). This inhibition disrupts cellular respiration and ATP production, making it a valuable tool in biochemical research and a potential candidate for therapeutic applications. Antimycin A2 is characterized by its complex molecular structure, which includes a polycyclic framework and various functional groups that contribute to its biological activity. It is typically found as a reddish-brown solid and is soluble in organic solvents. Due to its mechanism of action, antimycin A2 has been studied for its effects on various cellular processes and its potential use in cancer research and other areas of pharmacology. However, its use is limited by its toxicity and the need for careful handling in laboratory settings.
Formula:C27H38N2O9
InChI:InChI=1/C27H38N2O9/c1-5-7-8-9-12-19-24(38-21(31)11-6-2)17(4)37-27(35)22(16(3)36-26(19)34)29-25(33)18-13-10-14-20(23(18)32)28-15-30/h10,13-17,19,22,24,32H,5-9,11-12H2,1-4H3,(H,28,30)(H,29,33)
SMILES:CCCCCCC1C(C(C)OC(=O)C(C(C)OC1=O)N=C(c1cccc(c1O)N=CO)O)OC(=O)CCC
Synonyms:- 3-(3-Formamidosalicylamido)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl butyrate
- 3-({[3-(Formylamino)-2-Hydroxyphenyl]Carbonyl}Amino)-8-Hexyl-2,6-Dimethyl-4,9-Dioxo-1,5-Dioxonan-7-Yl Butanoate (Non-Preferred Name)
- Antimycin A<sub>2</sub>
- Butanoic acid, 3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester
- Antimycin A2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Antimycin A2
CAS:Antimycin A2 is the active component of Antimycin A, which inhibits cellular respiration by blocking the electron transport chain in fungi and insects.Formula:C27H38N2O9Color and Shape:SolidMolecular weight:534.6

