CAS 27225-00-9
:2,7-naphthyridin-1-amine
Description:
2,7-Naphthyridin-1-amine, with the CAS number 27225-00-9, is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms in the ring system. This compound features a naphthyridine core, which consists of a pyridine ring fused to another nitrogen-containing ring, specifically at the 2 and 7 positions. The presence of the amino group (-NH2) at the 1-position enhances its reactivity and solubility in polar solvents. 2,7-Naphthyridin-1-amine is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. It may exhibit various biological activities, including antimicrobial and anticancer properties. The compound's physical properties, such as melting point and solubility, can vary based on its purity and the specific conditions under which it is studied. Overall, 2,7-naphthyridin-1-amine is a significant compound in the field of organic and medicinal chemistry, warranting further exploration for its therapeutic potential.
Formula:C8H7N3
InChI:InChI=1/C8H7N3/c9-8-7-5-10-3-1-6(7)2-4-11-8/h1-5H,(H2,9,11)
SMILES:c1cncc2c1cc[nH]c2=N
Synonyms:- 2,7-Naphthyridin-1-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[2,7]NAPHTHYRIDIN-1-YLAMINE
CAS:Formula:C8H7N3Purity:98%Color and Shape:SolidMolecular weight:145.16132,7-Naphthyridin-1-amine
CAS:2,7-Naphthyridin-1-amine is a synthesized compound that has cytotoxic and antitumor activity. It has been shown to inhibit the growth of cervical cancer cells in vitro and induce apoptosis. 2,7-Naphthyridin-1-amine also has the potential to be used as an antitumor agent for hepatic cancers. Additionally, it mediates its cytotoxic effect by inhibiting protein synthesis and inducing cell death.Formula:C8H7N3Purity:Min. 95%Molecular weight:145.16 g/mol



