CAS 27230-51-9
:(4-pyridylthio)acetyl chloride hydrochloride
Description:
(4-Pyridylthio)acetyl chloride hydrochloride is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which contributes to its aromatic properties and potential reactivity. The presence of the thioether linkage (sulfur atom) enhances its nucleophilicity, making it useful in various synthetic applications, particularly in the formation of thioesters and other sulfur-containing compounds. As an acyl chloride, it is highly reactive, especially towards nucleophiles, and can undergo hydrolysis in the presence of water, releasing hydrochloric acid. This compound is typically handled with caution due to its corrosive nature and potential to release toxic fumes upon decomposition. It is often utilized in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. The hydrochloride form indicates that it is a salt, which can enhance its solubility in polar solvents. Overall, (4-pyridylthio)acetyl chloride hydrochloride is a valuable intermediate in chemical synthesis, with applications in various fields of chemistry.
Formula:C7H7Cl2NOS
InChI:InChI=1/C7H6ClNOS.ClH/c8-7(10)5-11-6-1-3-9-4-2-6;/h1-4H,5H2;1H
InChI key:InChIKey=ONINFWNBKWMUCA-UHFFFAOYSA-N
SMILES:S(CC(Cl)=O)C=1C=CN=CC1.Cl
Synonyms:- (Pyridin-4-Ylsulfanyl)Acetyl Chloride Hydrochloride (1:1)
- 4-Pyridylmercapto Acetyl Chloride Hydrochloride
- 4-Pyridylmercapto acetyl Chloride HCl
- 4-Pyridylmercaptoacetyl chloride hydrochloride
- Acetyl chloride, (4-pyridinylthio)-, hydrochloride
- Acetyl chloride, (4-pyridylthio)-, hydrochloride
- Acetyl chloride, 2-(4-pyridinylthio)-, hydrochloride (1:1)
- Pmac
- (4-Pyridylthio)acetyl chloride hydrochloride
- 4-PYRIDYLMERCAPTOACETYL CHLORIDE HCL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
