CAS 2724-67-6

Hydrazine, (2,4,5-trichlorophenyl)-, hydrochloride (1:1)

Description:

Hydrazine, (2,4,5-trichlorophenyl)-, hydrochloride (1:1), with CAS number 2724-67-6, is a chemical compound that belongs to the class of hydrazine derivatives. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents. This compound is characterized by the presence of a hydrazine functional group, which contributes to its reactivity and potential applications in various chemical syntheses. The trichlorophenyl moiety indicates the presence of three chlorine atoms attached to a phenyl ring, which can significantly influence the compound's biological activity and chemical properties. Hydrazine derivatives are known for their use in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. However, they can also pose health risks, including toxicity and potential carcinogenicity, necessitating careful handling and appropriate safety measures in laboratory and industrial settings. As with many chemical substances, understanding its properties and behavior is crucial for its safe and effective application.

Formula: C₆H₅Cl₃N₂·ClH

InChI: InChI=1S/C6H5Cl3N2.ClH/c7-3-1-5(9)6(11-10)2-4(3)8;/h1-2,11H,10H2;1H

InChI key: InChIKey=AFNQXLXFROTHSE-UHFFFAOYSA-N

SMILES: N(N)C1=C(Cl)C=C(Cl)C(Cl)=C1.Cl

Synonyms:

• Hydrazine, (2,4,5-trichlorophenyl)-, hydrochloride (1:1)
• N-(2,4,5-Trichlorophenyl)hydrazine hydrochloride
• 1-(2,4,5-Trichlorophenyl)hydrazine hydrochloride
• Hydrazine, (2,4,5-trichlorophenyl)-, monohydrochloride
• Hydrazine, (2,4,5-trichlorophenyl)-, hydrochloride