CAS 27241-98-1
:2-[benzyl(3-methylphenyl)amino]-N,N-diethyl-2-oxoethanaminium chloride
Description:
2-[Benzyl(3-methylphenyl)amino]-N,N-diethyl-2-oxoethanaminium chloride, with the CAS number 27241-98-1, is a quaternary ammonium compound characterized by its complex structure, which includes a benzyl group and a 3-methylphenyl moiety attached to a diethylamino group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can impart antimicrobial and biocidal activity. It is soluble in polar solvents, and its chloride salt form enhances its stability and solubility in aqueous solutions. The presence of the diethylamino and oxoethanaminium groups suggests potential applications in pharmaceuticals, particularly in drug delivery systems or as a precursor in organic synthesis. Additionally, the compound may exhibit specific interactions with biological membranes due to its amphiphilic nature, making it of interest in various biochemical applications. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C20H27ClN2O
InChI:InChI=1/C20H26N2O.ClH/c1-4-21(5-2)16-20(23)22(15-18-11-7-6-8-12-18)19-13-9-10-17(3)14-19;/h6-14H,4-5,15-16H2,1-3H3;1H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
m-Acetotoluidide, N-benzyl-2-(diethylamino)-, monohydrochloride
CAS:m-Acetotoluidide, N-benzyl-2-(diethylamino)-, monohydrochloride is a bioactive chemical.Formula:C20H27ClN2OColor and Shape:SolidMolecular weight:346.89
