CAS 27249-90-7

benzyl benzenecarbodithioate

Description:

Benzyl benzenecarbodithioate, with the CAS number 27249-90-7, is an organic compound characterized by its dithioate functional group. It typically appears as a yellow to brown liquid or solid, depending on its purity and specific conditions. This compound is known for its role as a chemical intermediate in organic synthesis and may exhibit properties such as moderate solubility in organic solvents. Its structure features a benzyl group attached to a benzenecarbodithioate moiety, which contributes to its reactivity and potential applications in various chemical reactions, including polymerization and as a stabilizer in certain formulations. Additionally, benzyl benzenecarbodithioate may possess specific biological activities, although detailed studies on its toxicity and environmental impact are essential for safe handling and application. As with many chemical substances, proper safety precautions should be observed when working with this compound, including the use of personal protective equipment and adherence to relevant safety guidelines.

Formula: C₁₄H₁₂S₂

InChI: InChI=1/C14H12S2/c15-14(13-9-5-2-6-10-13)16-11-12-7-3-1-4-8-12/h1-10H,11H2

SMILES: c1ccc(cc1)CSC(=S)c1ccccc1

Synonyms:

• Benzyl dithiobenzoate

Benzyl Benzodithioate

CAS: 27249-90-7

Benzyl Benzodithioate

Purity: 98%

Molecular weight: 244.38g/mol

Ref: 54-OR1012356

Benzyl Benzodithioate

CAS: 27249-90-7

Formula: C₁₄H₁₂S₂

Purity: >95.0%(GC)

Color and Shape: Orange to Brown to Dark red clear liquid

Molecular weight: 244.37

Ref: 3B-B6066

BENZYL BENZODITHIOATE

CAS: 27249-90-7

Formula: C₁₄H₁₂S₂

Purity: 98%

Molecular weight: 244.37

Ref: 10-F333979