
CAS 27251-84-9
:Mannose phosphate
Description:
Mannose phosphate, with the CAS number 27251-84-9, is a phosphorylated sugar derivative of mannose, a hexose monosaccharide. It is characterized by the presence of a phosphate group attached to the mannose molecule, which plays a crucial role in various biochemical pathways, particularly in glycoprotein synthesis and cellular signaling. Mannose phosphate is typically found in the form of a white crystalline powder and is soluble in water, making it readily available for biological processes. Its structure allows it to participate in the phosphorylation and dephosphorylation reactions that are essential for metabolic regulation. This compound is significant in the context of cellular metabolism and is involved in the mannose-6-phosphate pathway, which is important for lysosomal enzyme targeting. Additionally, mannose phosphate can be utilized in research and clinical settings, particularly in studies related to carbohydrate metabolism and enzyme function. Overall, its biochemical properties make it a valuable compound in both scientific research and potential therapeutic applications.
Formula:C6H13O9P
InChI:InChI=1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6?/m1/s1
InChI key:InChIKey=HXXFSFRBOHSIMQ-QTVWNMPRSA-N
SMILES:O(P(=O)(O)O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O
Synonyms:- D-Mannopyranose, 1-phosphate
- Mannosyl phosphate
- Mannopyranose, 1-(dihydrogen phosphate), D-
- D-Mannopyranose, 1-(dihydrogen phosphate)
- Mannose phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mannose 1-phosphate
CAS:Mannose 1-phosphate, an endogenous metabolite, serves as a substrate for the enzyme GDP-mannose pyrophosphorylase to synthesize GDP-Man [1].
Formula:C6H13O9PColor and Shape:SolidMolecular weight:260.14
