CAS 27255-10-3
:N-(6-chloropyridazin-3-yl)-beta-alanine
Description:
N-(6-chloropyridazin-3-yl)-beta-alanine is a chemical compound characterized by its unique structure, which includes a pyridazine ring substituted with a chlorine atom at the 6-position and a beta-alanine moiety. This compound typically exhibits properties associated with both the pyridazine and amino acid functionalities, such as potential solubility in polar solvents due to the presence of the amino group. The chlorinated pyridazine component may impart specific biological activities or interactions, making it of interest in pharmaceutical research. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, which are common in organic synthesis. Additionally, its potential applications may extend to areas such as drug development or as a biochemical probe, depending on its biological activity and interaction with target molecules. Overall, N-(6-chloropyridazin-3-yl)-beta-alanine represents a versatile compound with implications in medicinal chemistry and related fields.
Formula:C7H8ClN3O2
InChI:InChI=1/C7H8ClN3O2/c8-5-1-2-6(11-10-5)9-4-3-7(12)13/h1-2H,3-4H2,(H,9,11)(H,12,13)
SMILES:c1cc(=NCCC(=O)O)[nH]nc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-[(6-Chloropyridazin-3-yl)amino]propanoic acid
CAS:3-[(6-Chloropyridazin-3-yl)amino]propanoic acid
Molecular weight:201.61g/mol
