CAS 27257-15-4

1-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

1-Methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a methyl group attached to the nitrogen atom of the pyrrole ring, which influences its chemical reactivity and properties. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of both nitrogen atoms in the structure contributes to its basicity and potential for forming hydrogen bonds, making it a candidate for various chemical reactions, including electrophilic substitutions. Its unique structure allows it to participate in biological activities, which has garnered interest in medicinal chemistry and drug development. Additionally, this compound may exhibit fluorescence properties, making it useful in certain analytical applications. As with many nitrogen-containing heterocycles, it is important to handle 1-methyl-1H-pyrrolo[2,3-b]pyridine with care, as it may pose health risks if inhaled or ingested.

Formula: C₈H₈N₂

InChI: InChI=1/C8H8N2/c1-10-6-4-7-3-2-5-9-8(7)10/h2-6H,1H3

SMILES: Cn1ccc2cccnc12

Synonyms:

• 1H-pyrrolo[2,3-b]pyridine, 1-methyl-

1-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 27257-15-4

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 132.1625

Ref: IN-DA007LBU

1-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 27257-15-4

1-Methyl-1H-pyrrolo[2,3-b]pyridine exhibits cytotoxicity against MCF-7 cells and can be used in related research in the field of life sciences.

Formula: C₈H₈N₂

Purity: 98.89%

Color and Shape: Solid

Molecular weight: 132.16

Ref: TM-TN9609

1-Methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 27257-15-4

1-Methyl-1H-pyrrolo[2,3-b]pyridine

Purity: 99%

Molecular weight: 132.16g/mol

Ref: 54-OR907187

1-Methyl-7-azaindole

CAS: 27257-15-4

Formula: C₈H₈N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 132.166

Ref: 10-F076233