CymitQuimica logo

CAS 27260-42-0

:

N-[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]sulfamic acid

Description:
N-[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]sulfamic acid, with the CAS number 27260-42-0, is a chemical compound characterized by its complex structure, which includes a chloro-substituted aromatic ring, a sulfonamide functional group, and a diethylamino moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although its specific biological activity may vary. The presence of the methoxy group and the diethylamino group suggests that it may have enhanced lipophilicity, which can influence its solubility and permeability in biological systems. The compound's structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and acylation reactions, due to the presence of reactive functional groups. Additionally, its potential applications could span pharmaceuticals, agrochemicals, or as a research chemical, depending on its specific properties and biological interactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C14H22ClN3O5S
InChI:InChI=1S/C14H22ClN3O5S/c1-4-18(5-2)7-6-16-14(19)10-8-11(15)12(9-13(10)23-3)17-24(20,21)22/h8-9,17H,4-7H2,1-3H3,(H,16,19)(H,20,21,22)
InChI key:InChIKey=ZHMTXLHHLGRAPZ-UHFFFAOYSA-N
SMILES:C(NCCN(CC)CC)(=O)C1=C(OC)C=C(NS(=O)(=O)O)C(Cl)=C1
Synonyms:
  • N-[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]sulfamic acid
  • Sulfamic acid, [2-chloro-4-[[2-(diethylamino)ethyl]carbamoyl]-5-methoxyphenyl]-
  • Sulfamic acid, N-[2-chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]-
  • Sulfamic acid, [2-chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.