CAS 27267-70-5
:methyl (2S)-8,10'-dihydroxy-5,7-dimethoxy-4,9,9'-trioxo-4,4',9,9'-tetrahydro-3H,3'H-spiro[naphtho[2,3-b]furan-2,2'-pyrano[4,3-g]chromene]-7'-carboxylate
Description:
Methyl (2S)-8,10'-dihydroxy-5,7-dimethoxy-4,9,9'-trioxo-4,4',9,9'-tetrahydro-3H,3'H-spiro[naphtho[2,3-b]furan-2,2'-pyrano[4,3-g]chromene]-7'-carboxylate, with CAS number 27267-70-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and carboxylate (-COO-) groups. This compound features a spirocyclic framework, indicative of its unique stereochemistry and potential biological activity. The presence of multiple oxygen-containing groups suggests that it may exhibit significant polar characteristics, influencing its solubility and reactivity. Such compounds often have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential bioactive properties. The specific stereochemistry, as denoted by the (2S) configuration, may also play a crucial role in determining the compound's interaction with biological targets. Overall, this substance exemplifies the complexity and diversity found in organic chemistry, particularly in the realm of natural product derivatives.
Formula:C27H20O12
InChI:InChI=1/C27H20O12/c1-34-13-8-14(35-2)20(29)18-17(13)19(28)12-9-27(39-24(12)22(18)31)5-4-10-6-11-7-15(25(32)36-3)37-26(33)16(11)21(30)23(10)38-27/h6-8,29-30H,4-5,9H2,1-3H3/t27-/m0/s1
SMILES:COc1cc(c(c2c1C(=O)C1=C(C2=O)O[C@@]2(CCc3cc4cc(C(=O)OC)oc(=O)c4c(c3O2)O)C1)O)OC
Synonyms:- Spiro[benzo[1,2-b:5,4-c']dipyran-2(3H),2'(3'H)-naphtho[2,3-b]furan]-7-carboxylic acid, 4,4',9,9'-tetrahydro-8',10-dihydroxy-5',7'-dimethoxy-4',9,9'-trioxo-, methyl ester, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
β-Rubromycin
CAS:β-Rubromycin is a bacterial metabolite originally isolated from Streptomyces that has diverse biological activities.1 It inhibits the growth of HMO2, KATO-III,Formula:C27H20O12Color and Shape:SolidMolecular weight:536.445

