CAS 27267-71-6
:Methyl (2S)-4,5′,8′,9-tetrahydro-4′,9′,10-trihydroxy-7′-methoxy-5′,8′,9-trioxospiro[benzo[1,2-b:5,4-c′]dipyran-2(3H),2′(3′H)-naphtho[2,3-b]furan]-7-carboxylate
Description:
Methyl (2S)-4,5′,8′,9-tetrahydro-4′,9′,10-trihydroxy-7′-methoxy-5′,8′,9-trioxospiro[benzo[1,2-b:5,4-c′]dipyran-2(3H),2′(3′H)-naphtho[2,3-b]furan]-7-carboxylate, with CAS number 27267-71-6, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and carboxylate (-COO-) groups. This compound features a spirocyclic framework, indicative of its unique connectivity and stereochemistry, particularly with the presence of a chiral center at the 2S position. Its multiple keto and hydroxy groups suggest potential for hydrogen bonding and reactivity, which may influence its solubility and interaction with biological systems. The presence of a naphtho[2,3-b]furan moiety contributes to its aromatic character, potentially affecting its electronic properties and reactivity. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and natural product research.
Formula:C26H18O12
InChI:InChI=1S/C26H18O12/c1-34-13-7-12(27)16-17(19(13)29)21(31)23-11(18(16)28)8-26(38-23)4-3-9-5-10-6-14(24(32)35-2)36-25(33)15(10)20(30)22(9)37-26/h5-7,28,30-31H,3-4,8H2,1-2H3/t26-/m0/s1
InChI key:InChIKey=CKLKRRFSZZUFKT-SANMLTNESA-N
SMILES:OC1=C2O[C@@]3(CC2=C(O)C4=C1C(=O)C(OC)=CC4=O)OC=5C(CC3)=CC6=C(C5O)C(=O)OC(C(OC)=O)=C6
Synonyms:- γ-Rubromycin
- Methyl (2S)-4,5′,8′,9-tetrahydro-4′,9′,10-trihydroxy-7′-methoxy-5′,8′,9-trioxospiro[benzo[1,2-b:5,4-c′]dipyran-2(3H),2′(3′H)-naphtho[2,3-b]furan]-7-carboxylate
- Spiro[benzo[1,2-b:5,4-c′]dipyran-2(3H),2′(3′H)-naphtho[2,3-b]furan]-7-carboxylic acid, 4,5′,8′,9-tetrahydro-4′,9′,10-trihydroxy-7′-methoxy-5′,8′,9-trioxo-, methyl ester, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
γ-Rubromycin
CAS:<p>γ-Rubromycin is a natural product derived from Streptomyces bacteria and possesses antimicrobial activity.</p>Formula:C26H18O12Color and Shape:SolidMolecular weight:522.41
