CAS 2727-68-6
:2,2,2-trifluoro-N-(2-methylphenyl)acetamide
Description:
2,2,2-Trifluoro-N-(2-methylphenyl)acetamide, with the CAS number 2727-68-6, is an organic compound characterized by its trifluoromethyl group and an acetamide functional group. This compound features a central acetamide structure, where the nitrogen atom is substituted with a 2-methylphenyl group, providing aromatic characteristics. The presence of three fluorine atoms on the carbon adjacent to the amide group significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The trifluoromethyl group can enhance the compound's stability and reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit unique solubility characteristics due to the fluorine atoms, which can affect its interactions with other molecules. Overall, 2,2,2-trifluoro-N-(2-methylphenyl)acetamide is notable for its structural features that contribute to its potential utility in synthetic chemistry and medicinal applications.
Formula:C9H8F3NO
InChI:InChI=1/C9H8F3NO/c1-6-4-2-3-5-7(6)13-8(14)9(10,11)12/h2-5H,1H3,(H,13,14)
SMILES:Cc1ccccc1N=C(C(F)(F)F)O
Synonyms:- Acetamide, 2,2,2-trifluoro-N-(2-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,2,2-Trifluoro-N-(2-methylphenyl)acetamide
CAS:2,2,2-Trifluoro-N-(2-methylphenyl)acetamide
Molecular weight:203.16113g/mol2,2,2-trifluoro-N-(2-methylphenyl)acetamide
CAS:Controlled ProductFormula:C9H8F3NOColor and Shape:NeatMolecular weight:203.161


