CAS 27277-03-8

(5-amino-1H-1,2,4-triazol-3-yl)methanol

Description:

(5-amino-1H-1,2,4-triazol-3-yl)methanol, with the CAS number 27277-03-8, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features an amino group and a hydroxymethyl group, contributing to its potential reactivity and solubility in polar solvents. The presence of the amino group suggests that it may participate in hydrogen bonding and can act as a nucleophile in various chemical reactions. The triazole moiety is known for its biological activity, often serving as a scaffold in pharmaceuticals and agrochemicals. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in medicinal chemistry. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, (5-amino-1H-1,2,4-triazol-3-yl)methanol is a versatile compound with potential applications in various fields, including agriculture and drug development.

Formula: C₃H₆N₄O

InChI: InChI=1/C3H6N4O/c4-3-5-2(1-8)6-7-3/h8H,1H2,(H3,4,5,6,7)

SMILES: C(c1nc(=N)[nH][nH]1)O

Synonyms:

• 1H-1,2,4-triazole-3-methanol, 5-amino-

(5-Amino-1H-[1,2,4]triazol-3-yl)-methanol

CAS: 27277-03-8

Formula: C₃H₆N₄O

Purity: 99%

Color and Shape: Solid

Molecular weight: 114.1059

Ref: IN-DA00C20J

(5-Amino-1H-[1,2,4]triazol-3-yl)-methanol

CAS: 27277-03-8

Formula: C₃H₆N₄O

Purity: 90%

Color and Shape: Solid

Molecular weight: 114.108

Ref: 10-F057863

(5-Amino-1H-1,2,4-triazol-3-yl)methanol

CAS: 27277-03-8

Please enquire for more information about (5-Amino-1H-1,2,4-triazol-3-yl)methanol including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₃H₆N₄O

Purity: Min. 95%

Molecular weight: 114.11 g/mol

Ref: 3D-FA116857