CAS 272776-07-5

9-methyl[1,2,5]oxadiazolo[3,4-f]cinnoline

Description:

9-Methyl[1,2,5]oxadiazolo[3,4-f]cinnoline is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both oxadiazole and cinnoline moieties. This compound features a methyl group at the 9-position of the oxadiazole ring, contributing to its chemical properties and potential reactivity. It is typically a solid at room temperature and may exhibit various physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of nitrogen and oxygen in its structure suggests potential for hydrogen bonding and interactions with other molecules, which can influence its biological activity and applications in fields such as medicinal chemistry and materials science. Additionally, compounds of this type may exhibit interesting electronic properties due to their conjugated systems, making them candidates for studies in organic electronics or as fluorescent materials. As with many heterocycles, the synthesis and characterization of 9-methyl[1,2,5]oxadiazolo[3,4-f]cinnoline are of interest for developing new functional materials or pharmaceuticals.

Formula: C₉H₆N₄O

InChI: InChI=1/C9H6N4O/c1-5-4-10-11-6-2-3-7-9(8(5)6)13-14-12-7/h2-4H,1H3

SMILES: Cc1cnnc2ccc3c(c12)non3

9-Methyl-1,2,5-oxadiazolo[3,4-f]cinnoline

CAS: 272776-07-5

9-Methyl-1,2,5-oxadiazolo[3,4-f]cinnoline

Purity: ≥95%

Molecular weight: 186.17g/mol

Ref: 54-OR0639