CAS 2728-02-1
:p-Chlorophenprocoumon
Description:
p-Chlorophenprocoumon, with the CAS number 2728-02-1, is a chemical compound that belongs to the class of anticoagulants, specifically coumarin derivatives. It is characterized by its chlorinated phenyl group, which contributes to its pharmacological properties. This compound is primarily used in the medical field for its ability to inhibit vitamin K-dependent clotting factors, thereby preventing thromboembolic disorders. p-Chlorophenprocoumon exhibits a relatively high lipophilicity, which influences its absorption and distribution in biological systems. The compound is typically administered orally and has a long half-life, allowing for once-daily dosing in therapeutic applications. Its mechanism of action involves the inhibition of the enzyme vitamin K epoxide reductase, leading to decreased synthesis of clotting factors II, VII, IX, and X. As with other anticoagulants, careful monitoring of coagulation parameters is essential during treatment to avoid complications such as bleeding. Overall, p-Chlorophenprocoumon is an important agent in anticoagulation therapy, with specific characteristics that enhance its efficacy and safety profile.
Formula:C18H15ClO3
InChI:InChI=1S/C18H15ClO3/c1-2-13(11-7-9-12(19)10-8-11)16-17(20)14-5-3-4-6-15(14)22-18(16)21/h3-10,13,20H,2H2,1H3
InChI key:InChIKey=QGCOFSZSZWRICF-UHFFFAOYSA-N
SMILES:C(CC)(C1=C(O)C=2C(OC1=O)=CC=CC2)C3=CC=C(Cl)C=C3
Synonyms:- 2H-1-Benzopyran-2-one, 3-[1-(4-chlorophenyl)propyl]-4-hydroxy-
- 3-[1-(4-Chlorophenyl)propyl]-4-hydroxy-2H-1-benzopyran-2-one
- Coumarin, 3-(p-chloro-α-ethylbenzyl)-4-hydroxy-
- Enticide
- 3-[1′-(p-Chlorophenyl)propyl]-4-oxycoumarin
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
