CAS 27295-64-3

4-methyl-2,3-dihydro-1H-pyrrolo[3,4-c]quinoline-1,3-dione

Description:

4-Methyl-2,3-dihydro-1H-pyrrolo[3,4-c]quinoline-1,3-dione, with the CAS number 27295-64-3, is a heterocyclic organic compound characterized by its fused pyrrole and quinoline structures. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antimicrobial and anticancer properties. The presence of the methyl group at the 4-position and the dione functional groups contribute to its reactivity and solubility in various organic solvents. Its molecular structure allows for the possibility of forming hydrogen bonds, which can influence its interactions with biological targets. Additionally, the compound may undergo various chemical transformations, making it of interest in synthetic organic chemistry and medicinal chemistry. Due to its unique structure, it may also serve as a scaffold for the development of new pharmaceuticals. As with many heterocycles, it is important to handle this compound with care, considering its potential toxicity and the need for proper safety protocols during experimentation.

Formula: C₁₂H₈N₂O₂

InChI: InChI=1/C12H8N2O2/c1-6-9-10(12(16)14-11(9)15)7-4-2-3-5-8(7)13-6/h2-5H,1H3,(H,14,15,16)

SMILES: Cc1c2c(c3ccccc3n1)C(=O)N=C2O

Synonyms:

• 4-methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione

4-Methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione

CAS: 27295-64-3

4-Methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione

Purity: 95%

Color and Shape: Yellow Powder

Molecular weight: 212.20g/mol

Ref: 54-OR25028

4-Methyl-1H-pyrrolo[3,4-c]quinoline-1,3(2H)-dione

CAS: 27295-64-3

Purity: 97%

Molecular weight: 212.20799255371094

Ref: 10-F727481