CAS 273-15-4: 2,1,3-Benzoselenadiazole
Description:2,1,3-Benzoselenadiazole is a heterocyclic compound featuring a selenium atom within its structure, which is characterized by a fused benzene and diazole ring system. This compound is known for its unique electronic properties, making it of interest in various fields such as organic electronics and materials science. It typically exhibits a yellow to orange color and is relatively stable under standard conditions. The presence of selenium contributes to its reactivity and potential applications in photoconductive materials and sensors. Additionally, 2,1,3-benzoselenadiazole can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the electron-rich nature of the diazole ring. Its solubility can vary depending on the solvent, and it is generally considered to have moderate toxicity, necessitating careful handling in laboratory settings. Overall, 2,1,3-benzoselenadiazole is a valuable compound in research, particularly in the development of new materials and electronic devices.
Formula:C6H4N2Se
InChI:InChI=1S/C6H4N2Se/c1-2-4-6-5(3-1)7-9-8-6/h1-4H
InChI key:InChIKey=AYTPIVIDHMVGSX-UHFFFAOYSA-N
SMILES:N=1[Se]N=C2C=CC=CC12
- Synonyms:
- 2-Selena-1,3-diaza-2H-isoindene
- 3,4-Benzo-1,2,5-selenadiazole
- Ai3-52289
- Nsc 408467
- Phenylpiazselenole
- Piaselenole
- Piazselenol
- Piazselenole
- 2,1,3-Benzoselenadiazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,1,3-Benzoselenadiazole REF: 3B-B4313CAS: 273-15-4 | >98.0%(GC) | 129.00 €~429.00 € | Mon 17 Mar 25 |
![]() | 2,1,3-Benzoselenadiazole REF: IN-DA003F6GCAS: 273-15-4 | 97% | To inquire | Mon 24 Mar 25 |
![]() | Piaselenole REF: TM-T20536CAS: 273-15-4 | - - - | 1,444.00 € | Tue 25 Mar 25 |
![]() | 2,1,3-Benzoselenadiazole REF: 3D-AAA27315CAS: 273-15-4 | Min. 95% | - - - | Discontinued product |

2,1,3-Benzoselenadiazole
Ref: 3B-B4313
1g | 429.00 € | ||
200mg | 129.00 € |

2,1,3-Benzoselenadiazole
Ref: IN-DA003F6G
1g | 113.00 € | ||
5g | 218.00 € | ||
10g | 492.00 € | ||
25g | To inquire | ||
100mg | 34.00 € | ||
250mg | 50.00 € |

Piaselenole
Ref: TM-T20536
25mg | 1,444.00 € |

2,1,3-Benzoselenadiazole
Ref: 3D-AAA27315
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |