CAS 273-94-9
:2H-imidazo[4,5-b]pyrazine
Description:
2H-imidazo[4,5-b]pyrazine is a heterocyclic organic compound characterized by its fused imidazole and pyrazine rings. This compound features a bicyclic structure that contributes to its unique chemical properties. It is typically a colorless to pale yellow solid at room temperature and is soluble in polar organic solvents. The presence of nitrogen atoms in its structure enhances its reactivity and allows for various chemical modifications, making it of interest in medicinal chemistry and material science. 2H-imidazo[4,5-b]pyrazine exhibits potential biological activities, including antimicrobial and anticancer properties, which have been explored in various studies. Its molecular structure allows for interactions with biological targets, making it a candidate for drug development. Additionally, this compound can participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, further expanding its utility in synthetic chemistry. Overall, 2H-imidazo[4,5-b]pyrazine is a versatile compound with significant implications in both research and application.
Formula:C5H4N4
InChI:InChI=1/C5H4N4/c1-2-7-5-4(6-1)8-3-9-5/h1-2H,3H2
SMILES:c1cnc2=NCN=c2n1
Synonyms:- Imidazopyrazine
- 1H-Imidazo[4,5-B]Pyrazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazo[4,5-b]pyrazine
CAS:Imidazo[4,5-b]pyrazine is a chemical compound that binds to calcium ions and has been used in the treatment of metabolic disorders. The symptoms of imidazopyrazine include fatigue, weight loss, fever, chills, and muscle aches. Imidazopyrazine is also used for the treatment of autoimmune diseases such as rheumatoid arthritis. In vitro assays have shown that it activates macrophages and lymphocytes and may be useful in the treatment of skin lesions caused by an infection. Imidazopyrazine has been found to have pharmacokinetic properties with a half-life of 3 hours when administered orally. This drug has also been shown to have biological activity against rat liver microsomes.
Formula:C5H4N4Purity:Min. 95%Molecular weight:120.11 g/mol



