
CAS 27302-90-5
:Oxisuran
Description:
Oxisuran, with the CAS number 27302-90-5, is a chemical compound that belongs to the class of oxazolidinones. It is characterized by its unique molecular structure, which includes a five-membered ring containing both oxygen and nitrogen atoms. Oxisuran is primarily recognized for its potential applications in medicinal chemistry, particularly as an antimicrobial agent. The compound exhibits properties that may influence its solubility, stability, and reactivity, making it of interest in various chemical and pharmaceutical research contexts. Additionally, its synthesis and characterization involve standard organic chemistry techniques, and it may undergo various reactions typical of oxazolidinone derivatives. Safety and handling precautions are essential when working with Oxisuran, as with any chemical substance, due to potential toxicity or environmental impact. Overall, Oxisuran represents a noteworthy compound within its class, contributing to ongoing studies in drug development and chemical synthesis.
Formula:C8H9NO2S
InChI:InChI=1S/C8H9NO2S/c1-12(11)6-8(10)7-4-2-3-5-9-7/h2-5H,6H2,1H3
InChI key:InChIKey=DSWLRNLRVBAVFC-UHFFFAOYSA-N
SMILES:C(CS(C)=O)(=O)C1=CC=CC=N1
Synonyms:- Oxisuran
- Ketone, (methylsulfinyl)methyl 2-pyridyl
- 2-(Methylsulfinyl)-1-(2-pyridinyl)ethanone
- (Methylsulfinyl)methyl 2-pyridyl ketone
- Ethanone, 2-(methylsulfinyl)-1-(2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oxisuran
CAS:<p>Oxisuran is a biochemical.</p>Formula:C8H9NO2SColor and Shape:SolidMolecular weight:183.23
