
CAS 27306-05-4
:Decanoic acid, 10-amino-, homopolymer
Description:
Decanoic acid, 10-amino-, homopolymer, identified by CAS number 27306-05-4, is a synthetic polymer derived from the polymerization of decanoic acid and its amino derivative. This substance exhibits characteristics typical of polyamides, including good thermal stability and resistance to chemical degradation. It is generally soluble in organic solvents and has a relatively high melting point, which can vary based on the degree of polymerization and the specific structure of the polymer. The presence of amino groups in its structure imparts potential for hydrogen bonding, enhancing its mechanical properties and making it suitable for applications in coatings, adhesives, and as a surfactant. Additionally, the hydrophobic nature of the decanoic acid component contributes to its effectiveness in various formulations, particularly in enhancing water repellency. Overall, this polymer is notable for its balance of hydrophilic and hydrophobic characteristics, making it versatile in both industrial and consumer applications.
Formula:(C10H21NO2)x
InChI:InChI=1S/C10H21NO2/c11-9-7-5-3-1-2-4-6-8-10(12)13/h1-9,11H2,(H,12,13)
InChI key:InChIKey=XAUQWYHSQICPAZ-UHFFFAOYSA-N
SMILES:C(CCCCCN)CCCC(O)=O
Synonyms:- Poly(10-aminodecanoic acid)
- Decanoic acid, 10-amino-, polyamides
- 10-Aminodecanoic acid polymer
- 10-Aminodecanoic acid homopolymer
- Decanoic acid, 10-amino-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
