CAS 27313-54-8
:1-[[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]amino]-1-deoxy-β-D-glucopyranuronic acid
Description:
1-[[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]amino]-1-deoxy-β-D-glucopyranuronic acid, with CAS number 27313-54-8, is a complex organic compound characterized by its unique structural features. It contains a glucopyranuronic acid moiety, which is a derivative of glucose, indicating potential biological activity related to carbohydrate metabolism. The presence of a chloro group and a methoxy group suggests that it may exhibit specific reactivity and solubility properties, while the diethylamino group indicates potential for interaction with biological systems, possibly influencing its pharmacological profile. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its intricate structure suggests that it could participate in various chemical reactions, making it a candidate for further research in both synthetic and medicinal chemistry contexts. However, detailed studies would be necessary to fully elucidate its properties, including solubility, stability, and biological activity.
Formula:C20H30ClN3O8
InChI:InChI=1S/C20H30ClN3O8/c1-4-24(5-2)7-6-22-18(28)10-8-11(21)12(9-13(10)31-3)23-19-16(27)14(25)15(26)17(32-19)20(29)30/h8-9,14-17,19,23,25-27H,4-7H2,1-3H3,(H,22,28)(H,29,30)/t14-,15-,16+,17-,19+/m0/s1
InChI key:InChIKey=SOHPSIDRULBFFB-YUAHOQAQSA-N
SMILES:N([C@@H]1O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]1O)C2=CC(OC)=C(C(NCCN(CC)CC)=O)C=C2Cl
Synonyms:- β-D-Glucopyranuronic acid, 1-[[2-chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]amino]-1-deoxy-
- Metoclopramide N4-glucuronide
- 1-[[2-Chloro-4-[[[2-(diethylamino)ethyl]amino]carbonyl]-5-methoxyphenyl]amino]-1-deoxy-β-D-glucopyranuronic acid
- Glucopyranuronic acid, 1-[6-chloro-4-[[2-(diethylamino)ethyl]carbamoyl]-m-anisidino]-1-deoxy-, β-D-
- Metoclopramide N4-β-D-Glucuronide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Metoclopramide Impurity 34 (Metoclopramide N4-Glucuronide, M7)
CAS:Formula:C20H30ClN3O8Molecular weight:475.92Metoclopramide N4-β-D-Glucuronide
CAS:Controlled ProductFormula:C20H30ClN3O8Color and Shape:NeatMolecular weight:475.921Metoclopramide N4-β-D-glucuronide
CAS:Metoclopramide N4-β-D-glucuronide is an analog of metoclopramide, a medication used to treat nausea and vomiting. This compound has been found in human urine and has shown potential as an anticancer agent. It works by inhibiting kinases, which are enzymes involved in cell signaling pathways that regulate cell growth and division. Metoclopramide N4-β-D-glucuronide has been studied for its ability to inhibit the growth of cancer cells and induce apoptosis (cell death) in Chinese hamster ovary cells. It may have potential as a medicinal inhibitor of protein kinase activity for cancer treatment.Formula:C20H30ClN3O8Purity:Min. 95%Molecular weight:475.9 g/mol


