CAS 2732-17-4
:7-hydroxy-8-methyl-2H-chromen-2-one
Description:
7-Hydroxy-8-methyl-2H-chromen-2-one, commonly known as 7-hydroxyflavone, is a flavonoid compound characterized by its chromone structure, which consists of a benzopyran ring system. This compound features a hydroxyl group at the 7-position and a methyl group at the 8-position of the chromone ring, contributing to its unique chemical properties. It is typically a yellow to orange crystalline solid, soluble in organic solvents like ethanol and methanol, but less soluble in water. 7-Hydroxyflavone exhibits various biological activities, including antioxidant, anti-inflammatory, and potential neuroprotective effects, making it of interest in pharmacological research. Its ability to interact with various biological targets, including enzymes and receptors, is attributed to the presence of the hydroxyl group, which can participate in hydrogen bonding and enhance its reactivity. Additionally, this compound is often studied for its potential applications in food, cosmetics, and medicinal formulations due to its beneficial properties.
Formula:C10H8O3
InChI:InChI=1/C10H8O3/c1-6-8(11)4-2-7-3-5-9(12)13-10(6)7/h2-5,11H,1H3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
7-Hydroxy-8-methyl-2H-1-benzopyran-2-one
CAS:The 7-hydroxy-8-methyl-2H-1-benzopyran-2-one is a fluorescent probe that is used in the imaging of DNA and RNA. It has been shown to bind to nucleic acids with high affinity, and can be used to identify the location of specific sequences on DNA or RNA. The fluorescence of this probe can be detected using a microscope, which makes it useful for identifying specific regions of DNA or RNA.Formula:C10H8O3Purity:Min. 95%Molecular weight:176.17 g/mol
