CAS 2732-28-7: 1-(2-Methyl-4-pyridinyl)ethanone

Description:1-(2-Methyl-4-pyridinyl)ethanone, also known by its CAS number 2732-28-7, is an organic compound characterized by its pyridine ring structure, which contributes to its aromatic properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to a pyridine ring that has a methyl group at the 2-position and a nitrogen atom in the ring. The presence of the nitrogen atom in the pyridine ring imparts basicity and potential for hydrogen bonding, influencing its reactivity and solubility in various solvents. Typically, compounds like this exhibit moderate volatility and can be synthesized through various organic reactions, including acylation processes. Its applications may span across pharmaceuticals, agrochemicals, and as intermediates in organic synthesis, owing to its unique structural features. Additionally, the compound's physical properties, such as boiling point and melting point, can vary based on purity and environmental conditions, making it essential to refer to specific data sheets for precise information.

Formula:C₈H₉NO

InChI:InChI=1S/C8H9NO/c1-6-5-8(7(2)10)3-4-9-6/h3-5H,1-2H3

InChI key:InChIKey=NIGBUKPEJHINOG-UHFFFAOYSA-N

SMILES:O=C(C=1C=CN=C(C1)C)C

Synonyms:
1-(2-Methyl-4-pyridinyl)ethanone
1-(2-Methylpyridin-4-yl)ethan-1-one
2-Methyl-4-acetylpyridine
4-Acetyl-2-methylpyridine
Ethanone, 1-(2-Methyl-4-Pyridinyl)-
Ketone, methyl 2-methyl-4-pyridyl

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(2-METHYLPYRIDIN-4-YL)ETHANONE REF: IN-DA00BCUSCAS: 2732-28-7	97%	To inquire	Tue 15 Apr 25
4-Acetyl-2-methylpyridine REF: 54-OR902630CAS: 2732-28-7	95%	132.00 €	Wed 16 Apr 25
4-Acetyl-2-methylpyridine REF: 10-F076829CAS: 2732-28-7	95.0%	To inquire	Fri 25 Apr 25
1-(2-Methylpyridin-4-yl)ethanone REF: 3D-FM143015CAS: 2732-28-7	Min. 95%	- - -	Discontinued product