CAS 2733-88-2
:Nervonic acid methyl ester
Description:
Nervonic acid methyl ester, with the CAS number 2733-88-2, is an ester derived from nervonic acid, a long-chain monounsaturated fatty acid. It is characterized by its long hydrocarbon chain, which typically contains 24 carbon atoms and a double bond at the ninth carbon from the methyl end, contributing to its unsaturated nature. This compound is often studied for its potential biological significance, particularly in relation to neurological health, as nervonic acid is a component of sphingolipids found in the brain and nervous tissue. The methyl ester form enhances its solubility and stability, making it useful in various applications, including research and potential therapeutic uses. In terms of physical properties, it is generally a colorless to pale yellow liquid with a characteristic fatty odor. Its chemical behavior is influenced by the presence of the double bond, which can participate in various reactions typical of unsaturated fatty acids, such as oxidation or hydrogenation. Overall, nervonic acid methyl ester is of interest in both biochemical research and industrial applications.
Formula:C25H48O2
InChI:InChI=1S/C25H48O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(26)27-2/h10-11H,3-9,12-24H2,1-2H3/b11-10-
InChI key:InChIKey=AINIZSBLAFHZCP-KHPPLWFESA-N
SMILES:C(CCCCCCC/C=C\CCCCCCCC)CCCCCC(OC)=O
Synonyms:- 15-Tetracosenoic acid, methyl ester, (15Z)-
- 15-Tetracosenoic acid, methyl ester, (Z)-
- Methyl cis-15-tetracosenoate
- Methyl cis-tetracos-15-enoate
- Methyl nervonate
- methyl (15Z)-tetracos-15-enoate
- Nervonic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Methyl cis-15-tetracosenoate
CAS:Formula:C25H48O2Purity:(GC) ≥ 99.0%Color and Shape:Colourless liquidMolecular weight:380.65Methyl 15(Z)-Tetracosenoate
CAS:Formula:C25H48O2Purity:>99%Color and Shape:LiquidMolecular weight:380.65Nervonic acid-methyl ester 10 µg/mL in Cyclohexane
CAS:Formula:C25H48O2Color and Shape:Single SolutionMolecular weight:380.65Methyl cis-15-tetracosenoate
CAS:Methyl cis-15-tetracosenoate is a fatty acid that can be found in the milk of transgenic animals. This fatty acid has been shown to be an effective substitute for methyl ester compounds in biodiesel production, as it is less toxic and cheaper to produce than other fatty acids. Methyl cis-15-tetracosenoate is also a monocarboxylic acid that can be used in analytical methods to identify ester compounds. It can also be used as a surface methodology to determine if the aliphatic hydrocarbon is saturated or unsaturated.Formula:C25H48O2Purity:Min. 95%Molecular weight:380.65 g/mol






