CAS 27336-23-8
:1,1-Dibromo-1,2,2,2-tetrafluoroethane
Description:
1,1-Dibromo-1,2,2,2-tetrafluoroethane, with the CAS number 27336-23-8, is a halogenated organic compound primarily used as a refrigerant and in various industrial applications. This substance is characterized by its molecular structure, which includes two bromine atoms and four fluorine atoms attached to a two-carbon ethane backbone. It is a colorless gas or liquid at room temperature, exhibiting low volatility and high stability, which makes it suitable for use in refrigeration systems. The presence of bromine and fluorine contributes to its chemical reactivity and potential environmental impact, particularly concerning ozone depletion and greenhouse gas effects. 1,1-Dibromo-1,2,2,2-tetrafluoroethane has a relatively low boiling point and is non-flammable, which are important safety considerations in its handling and application. Additionally, it is subject to regulatory scrutiny due to its halogenated nature, which raises concerns about its persistence in the atmosphere and potential for contributing to climate change.
Formula:C2Br2F4
InChI:InChI=1/C6H4BrFO/c7-5-3-4(9)1-2-6(5)8/h1-3,9H
InChI key:InChIKey=JLGADZLAECENGR-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(Br)(Br)F
Synonyms:- 1,1,1,2-Tetrafluoro-2,2-dibromoethane
- 1,1-Dibromo-1,2,2,2-tetrafluoroethane
- Ethane, 1,1-dibromo-1,2,2,2-tetrafluoro-
- Ethane, 1,1-dibromotetrafluoro-
- 1,1-Dibromotetrafluoroethane
- 2,2-Dibromo-1,1,1,2-tetrafluoroethane
- FC-114AB2
- 1,1-Dibromotetrafluoroethane(FC-114aB2)98%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.