CAS 273384-78-4: α-Methyl-2-(trifluoromethyl)benzenemethanamine

Description:α-Methyl-2-(trifluoromethyl)benzenemethanamine, with the CAS number 273384-78-4, is an organic compound characterized by its aromatic structure and the presence of both a methyl group and a trifluoromethyl group attached to a benzene ring. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing the compound's overall stability and reactivity. The presence of fluorine atoms can also affect the compound's boiling and melting points, making it distinct from similar compounds without fluorine. Additionally, the α-methyl substitution can influence steric hindrance and the compound's interaction with biological systems, potentially making it of interest in pharmaceutical research. Overall, α-Methyl-2-(trifluoromethyl)benzenemethanamine is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.

Formula:C₉H₁₀F₃N

InChI:InChI=1S/C9H10F3N/c1-6(13)7-4-2-3-5-8(7)9(10,11)12/h2-6H,13H2,1H3

InChI key:InChIKey=DPLIMKBGTYIUCB-UHFFFAOYSA-N

SMILES:FC(F)(F)C=1C=CC=CC1C(N)C

Synonyms:
(1-[2-(Trifluoromethyl)phenyl]ethylamine
1-[2-(Trifluoromethyl)phenyl]ethan-1-amine
α-Methyl-2-(trifluoromethyl)benzenemethanamine
Benzenemethanamine, α-methyl-2-(trifluoromethyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-(2-(Trifluoromethyl)phenyl)ethanamine REF: IN-DA003CVRCAS: 273384-78-4	97%	33.00 €~222.00 €	Wed 23 Apr 25
α-Methyl-2-(trifluoromethyl)benzylamine REF: 54-PC4462CAS: 273384-78-4	97%	78.00 €~376.00 €	Wed 30 Apr 25
1-(2-(Trifluoromethyl)phenyl)ethanamine REF: 10-F446288CAS: 273384-78-4	95.0%	To inquire	Mon 05 May 25
1-(2-Trifluoromethylphenyl)ethylamine REF: 3D-FT83780CAS: 273384-78-4	Min. 95%	- - -	Discontinued product