CAS 27339-38-4

3-Formylfuran-2-boronic acid

Description:

3-Formylfuran-2-boronic acid is an organic compound characterized by the presence of both a furan ring and a boronic acid functional group. The furan ring contributes to its aromatic properties, while the formyl group (–CHO) introduces reactivity typical of aldehydes. The boronic acid moiety (–B(OH)2) is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. Its reactivity allows it to participate in cross-coupling reactions, particularly in the formation of carbon-carbon bonds, which is a valuable feature in the synthesis of complex organic molecules. Additionally, 3-Formylfuran-2-boronic acid may exhibit biological activity, making it of interest in pharmaceutical research. Proper handling and storage are essential due to the potential reactivity of the boronic acid group.

Formula: C₅H₅BO₄

InChI: InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H

SMILES: c1coc(c1C=O)B(O)O

Synonyms:

• 2-Borono-3-furaldehyde
• (3-Formylfuran-2-Yl)Boronic Acid

(3-Formylfuran-2-yl)boronic acid

CAS: 27339-38-4

Formula: C₅H₅BO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.9018

Ref: IN-DA003JI5

3-Formylfuran-2-boronic acid

CAS: 27339-38-4

3-Formylfuran-2-boronic acid

Formula: C₅H₅BO₄

Purity: 97%

Color and Shape: pale orange powder

Molecular weight: 139.90g/mol

Ref: 54-OR8668

3-Formylfuran-2-boronic acid

CAS: 27339-38-4

Formula: C₅H₅BO₄

Purity: 97.0%

Molecular weight: 139.9

Ref: 10-F011037

3-Formylfuran-2-boronic acid

CAS: 27339-38-4

3-Formylfuran-2-boronic acid is a molecule that can reversibly form an imine with primary amines. 3-Formyl group and fluorophore are the main features of this molecule. The fluorescent properties of 3-formyl group have been extensively studied by functional theory, structural studies and kinetic experiments. The study of these properties has led to the discovery of new fluorescent probes for use in biochemical studies. 3-Formyl furan also interacts with anthracene and other heterocycles by binding constants. These interactions were studied using quantum chemical calculations.

Formula: C₅H₅BO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 139.9 g/mol

Ref: 3D-FF149403