CAS 273409-54-4
:tert-butyl N-(3-aminopropyl)-N-ethyl-carbamate
Description:
Tert-butyl N-(3-aminopropyl)-N-ethyl-carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonic acid derivative. This compound features a tert-butyl group, providing steric hindrance and influencing its solubility and reactivity. The presence of the 3-aminopropyl and N-ethyl substituents contributes to its potential biological activity and interaction with various receptors or enzymes. Typically, compounds like this may exhibit moderate to high polarity due to the amine and carbamate functionalities, affecting their solubility in polar solvents. The molecular structure suggests potential applications in medicinal chemistry, particularly in drug design, where modifications to the amine and carbamate groups can enhance pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, tert-butyl N-(3-aminopropyl)-N-ethyl-carbamate represents a versatile structure in organic synthesis and pharmaceutical development.
Formula:C10H22N2O2
InChI:InChI=1/C10H22N2O2/c1-5-12(8-6-7-11)9(13)14-10(2,3)4/h5-8,11H2,1-4H3
SMILES:CCN(CCCN)C(=O)OC(C)(C)C
Synonyms:- tert-Butyl (3-aminopropyl)ethylcarbamate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl 3-aminopropyl(ethyl);carbamate
CAS:Formula:C10H22N2O2Purity:97%Color and Shape:LiquidMolecular weight:202.2939tert-Butyl 3-aminopropyl(ethyl)carbamate
CAS:tert-Butyl 3-aminopropyl(ethyl)carbamatePurity:97%Molecular weight:202.29g/moltert-Butyl 3-Aminopropyl(ethyl)carbamate
CAS:Formula:C10H22N2O2Purity:97%Color and Shape:OilMolecular weight:202.298(3-Aminopropyl)ethyl-carbamic Acid tert-Butyl Ester
CAS:Controlled Product<p>Applications (3-Aminopropyl)ethyl-carbamic Acid tert-Butyl Ester is a reactant used in the preparation of pyrimidin-2-one derivatives as CSBP/RK/p38 kinase inhibitors.<br></p>Formula:C10H22N2O2Color and Shape:NeatMolecular weight:202.29tert-Butyl 3-aminopropyl(ethyl)carbamate
CAS:Versatile small molecule scaffoldFormula:C10H22N2O2Purity:Min. 95%Molecular weight:202.3 g/mol




