CAS 27350-16-9

1H-2,3-Benzothiazin-4-amine, 2,2-dioxide

Description:

1H-2,3-Benzothiazin-4-amine, 2,2-dioxide, commonly referred to as benzothiazinone, is a heterocyclic compound characterized by its benzothiazine structure, which includes a sulfur atom and a nitrogen atom within a fused ring system. This compound is known for its potential biological activity, particularly in the field of medicinal chemistry, where it has been investigated for its antibacterial properties, especially against Mycobacterium tuberculosis. The presence of the 2,2-dioxide functional group enhances its reactivity and solubility, making it a subject of interest in drug development. Physically, it is typically a solid at room temperature, and its solubility can vary depending on the solvent used. The compound's molecular structure contributes to its pharmacological properties, and ongoing research aims to elucidate its mechanisms of action and optimize its efficacy as a therapeutic agent. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₈H₈N₂O₂S

InChI: InChI=1S/C8H8N2O2S/c9-8-7-4-2-1-3-6(7)5-13(11,12)10-8/h1-4H,5H2,(H2,9,10)

InChI key: InChIKey=GIKQLEFWTSOVGZ-UHFFFAOYSA-N

SMILES: NC=1C=2C(CS(=O)(=O)N1)=CC=CC2

Synonyms:

• 1H-2,3-Benzothiazin-4-amine, 2,2-dioxide
• 1H-2,3-Benzothiazine, 3,4-dihydro-4-imino-, 2,2-dioxide

4-Imino-3,4-dihydro-1H-2,3-benzothiazine-2,2-dione

CAS: 27350-16-9

Versatile small molecule scaffold

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.23 g/mol

Ref: 3D-CBA35016