CAS 2736-23-4: 5-(Aminosulfonyl)-2,4-dichlorobenzoic acid
Description:5-(Aminosulfonyl)-2,4-dichlorobenzoic acid, with the CAS number 2736-23-4, is an organic compound characterized by its sulfonamide functional group and dichlorobenzoic acid structure. This compound typically appears as a solid and is known for its role in various chemical applications, including pharmaceuticals and agrochemicals. The presence of the aminosulfonyl group imparts specific biological activity, making it relevant in medicinal chemistry, particularly in the development of drugs targeting bacterial infections or other therapeutic areas. The dichloro substituents on the benzene ring enhance its reactivity and influence its solubility and stability in different solvents. Additionally, this compound may exhibit properties such as moderate to high melting points and varying solubility in polar and non-polar solvents, depending on the specific conditions. Safety data sheets should be consulted for handling and toxicity information, as compounds with sulfonamide groups can sometimes cause allergic reactions in sensitive individuals. Overall, 5-(Aminosulfonyl)-2,4-dichlorobenzoic acid is a significant compound in both research and industrial applications.
Formula:C7H5Cl2NO4S
InChI:InChI=1S/C7H5Cl2NO4S/c8-4-2-5(9)6(15(10,13)14)1-3(4)7(11)12/h1-2H,(H,11,12)(H2,10,13,14)
InChI key:InChIKey=ZSHHRBYVHTVRFK-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(C(Cl)=CC1Cl)S(=O)(=O)N
- Synonyms:
- 2,4 Dichloro-5-Sulfamoyl Benzoic Acid(Lasamide/Dsba)
- 2,4-Dichloro-5-Sulfamoyl Benzoic Acid
- 2,4-Dichloro-5-Sulfamoylbenzoate
- 2,4-dichloro-5-sulfonyl Benzoic Acid
- 3-Sulfamoyl-4,6-dichlorobenzoic acid
- 5-(Aminosulfonyl)-2,4-dichlorobenzoic Acid
- 5-Carboxy-2,4-dichlorobenzenesulfonamide
- Benzoic acid, 2,4-dichloro-5-sulfamoyl-
- Benzoic acid, 5-(aminosulfonyl)-2,4-dichloro-
- Intermediates of Furosemide (Lasamide)
- See more synonyms
- Lassamide
- Sodium 2,4-Dichloro-5-Sulfamoylbenzoate
- 2,4-Dichloro-5-sulfamoylbenzoic acid
