CAS 27372-03-8
:Ethyl 3-hydroxy-2-methylbutyrate
Description:
Ethyl 3-hydroxy-2-methylbutyrate, with the CAS number 27372-03-8, is an organic compound that belongs to the class of esters. It is characterized by its molecular structure, which includes a hydroxyl group (-OH) and a branched alkyl chain, contributing to its unique properties. This compound is typically a colorless to pale yellow liquid with a fruity odor, making it appealing for use in flavoring and fragrance applications. Ethyl 3-hydroxy-2-methylbutyrate is soluble in organic solvents and exhibits moderate solubility in water, which is common for many esters. Its chemical behavior is influenced by the presence of the hydroxyl group, allowing for potential hydrogen bonding and reactivity in various chemical reactions. Additionally, it may be involved in metabolic pathways and has been studied for its potential applications in food science and biochemistry. Safety data indicates that, like many organic compounds, it should be handled with care, following appropriate safety guidelines to minimize exposure.
Formula:C7H14O3
InChI:InChI=1S/C7H14O3/c1-4-10-7(9)5(2)6(3)8/h5-6,8H,4H2,1-3H3
InChI key:InChIKey=BZFWGBFTIQSEBN-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(C(C)O)C
Synonyms:- Butanoic Acid, 3-Hydroxy-2-Methyl-, Ethyl Ester
- Butyric acid, 3-hydroxy-2-methyl-, ethyl ester
- Ethyl 3-hydroxy-2-methylbutyrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Hydroxy-2-methylbutanoic Acid Ethyl Ester(Mixture of Diastereomers)
CAS:Controlled ProductApplications 3-Hydroxy-2-methylbutanoic Acid Ethyl Ester_x000D_(Mixture of Diastereomers) (cas# 27372-03-8) is a compound useful in organic synthesis.
Formula:C7H14O3Color and Shape:NeatMolecular weight:146.18
