CAS 27374-25-0
:1-Ethoxy-1-trimethylsiloxylcyclopropane
Description:
1-Ethoxy-1-trimethylsiloxylcyclopropane, with the CAS number 27374-25-0, is a chemical compound characterized by its unique structure that includes a cyclopropane ring, an ethoxy group, and a trimethylsiloxyl moiety. This compound typically exhibits properties associated with both organic and siloxane chemistry, such as moderate volatility and potential reactivity due to the presence of the cyclopropane ring, which can undergo ring-opening reactions under certain conditions. The ethoxy group contributes to its solubility in organic solvents, while the siloxyl component may impart thermal stability and flexibility. The presence of silicon in the structure can also enhance its compatibility with various materials, making it useful in applications such as sealants, adhesives, and coatings. Additionally, the compound may exhibit interesting physical properties, including a specific boiling point and density, which can be influenced by its molecular structure. Overall, 1-Ethoxy-1-trimethylsiloxylcyclopropane represents a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C8H18O2Si
InChI:InChI=1/C8H18O2Si/c1-5-9-8(6-7-8)10-11(2,3)4/h5-7H2,1-4H3
SMILES:CCOC1(CC1)O[Si](C)(C)C
Synonyms:- Cyclopropanone ethyl trimethylsilyl acetal
- (1-Ethoxycyclopropoxy)trimethylsilane
- [(1-Ethoxycyclopropyl)Oxy](Trimethyl)Silane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(1-Ethoxycyclopropoxy)trimethylsilane
CAS:Formula:C8H18O2SiPurity:97%Color and Shape:SolidMolecular weight:174.3128(1-Ethoxycyclopropyloxy)trimethylsilane
CAS:Formula:C8H18O2SiPurity:(GC) ≥ 98.0%Color and Shape:Clear, colourless to light yellow liquidMolecular weight:174.31(1-Ethoxycyclopropoxy)trimethylsilane
CAS:(1-Ethoxycyclopropoxy)trimethylsilaneFormula:C8H18O2SiPurity:≥95%Color and Shape: colourless liquidMolecular weight:174.31g/mol(1-Ethoxycyclopropoxy)trimethylsilane
CAS:Controlled Product<p>Applications (1-Ethoxycyclopropoxy)trimethylsilane used as a reactant in the synthesis of di-, tri- and tetracyclopropylhydrazines. Also used as reagent in the synthesis of g elsemoxonine which is found in gelsemium plant species that is used in traditional asian medicine.<br> Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package<br>References Shestakov, A., et al.: Chem. Commun., 52, 2398 (2016); Diethelm, S., et al.: J. Am. Chem. Soc., 137, 6084 (2015);<br></p>Formula:C8H18O2SiColor and Shape:NeatMolecular weight:174.31(1-Ethoxycyclopropoxy)trimethylsilane
CAS:<p>S25327 - (1-Ethoxycyclopropoxy)trimethylsilane</p>Formula:C8H18O2SiPurity:95%Color and Shape:LiquidMolecular weight:174.315(1-Ethoxycyclopropoxy)trimethylsilane
CAS:<p>1-Ethoxycyclopropoxy)trimethylsilane is a cyclopropylamine that contains a hydroxyl group. It is used in the palladium-catalyzed coupling of an amine and an alkyne to form a 1,2-diaminocyclohexane. 1-Ethoxycyclopropoxy)trimethylsilane has been shown to be a CB2 receptor agonist in an animal model of diabetic neuropathy. It produces analgesia by binding to the cb2 receptor and activating it. 1-Ethoxycyclopropoxy)trimethylsilane has also been shown to have anticancer activity against human cancer cells, but not normal cells, which may be due to its selectivity for kinases that are over expressed in cancer cells.</p>Formula:C8H18O2SiPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:174.31 g/mol





