CAS 273749-25-0: (2,3-diaminophenyl)methanol

Description:(2,3-Diaminophenyl)methanol is an organic compound characterized by the presence of both amine and alcohol functional groups. It features a phenyl ring substituted with two amino groups at the 2 and 3 positions, along with a hydroxymethyl group (-CH2OH) attached to the aromatic system. This structure imparts unique chemical properties, including the ability to participate in hydrogen bonding due to the hydroxyl group, which can enhance solubility in polar solvents. The amino groups can act as nucleophiles, making the compound reactive in various chemical reactions, such as acylation or alkylation. Additionally, the presence of multiple functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The compound's reactivity and solubility characteristics may also be influenced by the pH of the environment, as the amino groups can exist in protonated or deprotonated forms depending on the conditions. Overall, (2,3-diaminophenyl)methanol is a versatile compound with significant potential in various chemical applications.

Formula:C₇H₁₀N₂O

InChI:InChI=1/C7H10N2O/c8-6-3-1-2-5(4-10)7(6)9/h1-3,10H,4,8-9H2