CAS 27376-74-5
:13,14-Dihydro-PGF2α
Description:
13,14-Dihydro-PGF2α is a prostaglandin analog that is derived from prostaglandin F2α (PGF2α), which plays a significant role in various physiological processes, including the regulation of blood pressure, inflammation, and reproductive functions. This compound is characterized by its structural modifications that include the saturation of the double bond between the 13 and 14 carbon atoms, which alters its biological activity compared to its parent compound. 13,14-Dihydro-PGF2α exhibits potent effects on smooth muscle contraction and is involved in mediating uterine contractions, making it relevant in reproductive health and potential therapeutic applications. It is also studied for its role in modulating vascular responses and has implications in cardiovascular research. The compound is typically handled in a laboratory setting, requiring proper safety protocols due to its biological activity. Its CAS number, 27376-74-5, is used for identification in chemical databases and regulatory contexts. Overall, 13,14-Dihydro-PGF2α is an important compound in pharmacology and biochemistry, with ongoing research into its mechanisms and potential therapeutic uses.
Formula:C20H36O5
InChI:InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,15-19,21-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/b7-4-/t15-,16+,17+,18-,19+/m0/s1
InChI key:InChIKey=LLQBSJQTCKVWTD-NFUXFLSFSA-N
SMILES:C(/C=C\CCCC(O)=O)[C@@H]1[C@@H](CC[C@H](CCCCC)O)[C@H](O)C[C@@H]1O
Synonyms:- 5-Heptenoic acid, 7-[3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]-, stereoisomer
- 13,14-Dihydroprostaglandin F2α
- Dihydroprostaglandin F2α
- Prost-5-en-1-oic acid, 9,11,15-trihydroxy-, (5Z,9α,11α,15S)-
- (5Z,9α,11α,15S)-9,11,15-Trihydroxyprost-5-en-1-oic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
13,14-dihydro Prostaglandin F2α
CAS:<p>13,14-dihydro Prostaglandin F2α (13,14-dihydro PGF2α) is the analog of PGF2α which has no unsaturation in the lower side chain.</p>Formula:C20H36O5Color and Shape:SolidMolecular weight:356.50313,14-Dihydro-PGF2α
CAS:Controlled ProductFormula:C20H36O5Color and Shape:NeatMolecular weight:356.50

