CymitQuimica logo

CAS 27383-86-4

:

methyl 1,3-benzoxazole-2-carboxylate

Description:
Methyl 1,3-benzoxazole-2-carboxylate is an organic compound characterized by its benzoxazole ring structure, which is a fused bicyclic system containing both benzene and oxazole moieties. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in various solvents. It is typically a white to off-white solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the methyl ester group enhances its lipophilicity, making it more permeable through biological membranes. Methyl 1,3-benzoxazole-2-carboxylate may exhibit fluorescence properties, which can be useful in analytical applications. Additionally, its structure allows for various chemical modifications, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, this compound is of interest in both research and industrial contexts due to its unique chemical properties and potential utility.
Formula:C9H7NO3
InChI:InChI=1/C9H7NO3/c1-12-9(11)8-10-6-4-2-3-5-7(6)13-8/h2-5H,1H3
InChI key:YDKNBNOOCSNPNS-UHFFFAOYSA-N
SMILES:COC(=O)c1nc2ccccc2o1
Synonyms:
  • 2-Benzoxazolecarboxylic Acid, Methyl Ester
  • Methyl 1,3-benzoxazole-2-carboxylate
Found 4 products.