CAS 27385-97-3

5-[(2-methylphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione

Description:

5-[(2-Methylphenyl)amino]-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features an amino group attached to a 2-methylphenyl moiety, contributing to its potential biological activity. The thiadiazole structure is known for its diverse applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can influence the compound's reactivity and stability. This substance may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential interactions with biological targets, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.

Formula: C₉H₉N₃S₂

InChI: InChI=1/C9H9N3S2/c1-6-4-2-3-5-7(6)10-8-11-12-9(13)14-8/h2-5H,1H3,(H,10,11)(H,12,13)

SMILES: Cc1ccccc1N=c1[nH]nc(S)s1

Synonyms:

• 1,3,4-Thiadiazole-2-Thiol, 5-[(2-Methylphenyl)Amino]-
• 5-[(2-Methylphenyl)amino]-1,3,4-thiadiazole-2-thiol
• 5-o-Tolylamino-[1,3,4]thiadiazole-2-thiol

5-[(2-Methylphenyl)amino]-1,3,4-thiadiazole-2-thiol

CAS: 27385-97-3

Versatile small molecule scaffold

Formula: C₉H₉N₃S₂

Purity: Min. 95%

Molecular weight: 223.3 g/mol

Ref: 3D-CBA38597