CAS 2739-12-0
:Benzenamine, N-methyl-, hydrochloride (1:1)
Description:
Benzenamine, N-methyl-, hydrochloride (1:1), also known as N-methyl-aniline hydrochloride, is an organic compound characterized by the presence of a methyl group attached to the nitrogen of an aniline structure, along with a hydrochloride salt form. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride group, which enhances its solubility compared to its free base form. It has applications in various fields, including organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. The compound exhibits basic properties due to the amine functional group, allowing it to participate in various chemical reactions, such as alkylation and acylation. Safety considerations include handling it with care, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used during handling. As with many amines, it may also have specific environmental impacts, necessitating proper disposal methods.
Formula:C7H9N·ClH
InChI:InChI=1S/C7H9N.ClH/c1-8-7-5-3-2-4-6-7;/h2-6,8H,1H3;1H
InChI key:InChIKey=ZCXOSDRICFIHTA-UHFFFAOYSA-N
SMILES:N(C)C1=CC=CC=C1.Cl
Synonyms:- Aniline, N-methyl-, hydrochloride
- Benzenamine, N-methyl-, hydrochloride
- Benzenamine, N-methyl-, hydrochloride (1:1)
- N-Methylaniline Hydrochloride
- N-Methylanilinium chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Methylaniline Hydrochloride
CAS:Controlled Product<p>Applications N-Methylaniline Hydrochloride (cas# 2739-12-0) is a useful research chemical.<br></p>Formula:C7H9N·HClColor and Shape:NeatMolecular weight:107.15 + (36.46)
