CAS 27398-39-6

3-Chloropyrazine-2-carboxylic acid

Description:

3-Chloropyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The compound features a carboxylic acid functional group (-COOH) at the 2-position and a chlorine atom at the 3-position of the pyrazine ring. This substitution pattern contributes to its unique chemical properties, including its potential acidity and reactivity. The presence of the chlorine atom can influence the compound's polarity and solubility in various solvents, making it useful in synthetic organic chemistry. 3-Chloropyrazine-2-carboxylic acid may serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals. Its structure allows for various chemical reactions, such as nucleophilic substitutions or coupling reactions, which are valuable in the development of more complex molecules. Additionally, the compound's properties can be further explored through its interactions with biological systems, potentially leading to applications in medicinal chemistry.

Formula: C₅H₃ClN₂O₂

InChI: InChI=1/C5H3ClN2O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H,9,10)

SMILES: c1cnc(c(C(=O)O)n1)Cl

Synonyms:

• 3-Chloro-2-Pyrazine-Carboxylic Acid

3-chloropyrazine-2-carboxylic acid

CAS: 27398-39-6

Formula: C₅H₃ClN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 158.5425

Ref: IN-DA003JBK

3-Chloropyrazine-2-carboxylic acid

CAS: 27398-39-6

Purity: 95%

Molecular weight: 158.543

Ref: FT-CAPOC13334

3-Chloropyrazine-2-carboxylic acid

CAS: 27398-39-6

3-Chloropyrazine-2-carboxylic acid

Purity: 96%

Color and Shape: Solid

Molecular weight: 158.54g/mol

Ref: 54-OR322467

3-Chloro-2-pyrazine-carboxylic acid

CAS: 27398-39-6

3-Chloro-2-pyrazinecarboxylic acid is a nucleophilic compound that is synthetically produced and has antimicrobial properties. It is an active component of the drug 3,4 dichloro-2-pyrazinecarboxylic acid (DCP). This agent binds to the chloride ion in bacterial cells, which inactivates the enzyme adenosine triphosphatase that is essential for maintaining cellular homeostasis. 3-Chloro-2-pyrazinecarboxylic acid has been shown to be active against a number of Gram positive and Gram negative bacteria, including Staphylococcus epidermidis, Streptococcus pneumoniae, and Pseudomonas aeruginosa. It also has antibacterial activity against mycobacteria such as Mycobacterium tuberculosis and Mycobacterium avium complex.

Formula: C₅H₃ClN₂O₂

Purity: Min. 95%

Color and Shape: Off-White To Light Brown Solid

Molecular weight: 158.54 g/mol

Ref: 3D-FC56419

3-Chloro-2-pyrazine-carboxylic acid

CAS: 27398-39-6

Formula: C₅H₃ClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 158.54

Ref: 10-F040204