CAS 27398-39-6
:3-Chloropyrazine-2-carboxylic acid
Description:
3-Chloropyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 4 positions. The compound features a carboxylic acid functional group (-COOH) at the 2-position and a chlorine atom at the 3-position of the pyrazine ring. This substitution pattern contributes to its unique chemical properties, including its potential acidity and reactivity. The presence of the chlorine atom can influence the compound's polarity and solubility in various solvents, making it useful in synthetic organic chemistry. 3-Chloropyrazine-2-carboxylic acid may serve as an intermediate in the synthesis of pharmaceuticals, agrochemicals, or other fine chemicals. Its structure allows for various chemical reactions, such as nucleophilic substitutions or coupling reactions, which are valuable in the development of more complex molecules. Additionally, the compound's properties can be further explored through its interactions with biological systems, potentially leading to applications in medicinal chemistry.
Formula:C5H3ClN2O2
InChI:InChI=1/C5H3ClN2O2/c6-4-3(5(9)10)7-1-2-8-4/h1-2H,(H,9,10)
SMILES:c1cnc(c(C(=O)O)n1)Cl
Synonyms:- 3-Chloro-2-Pyrazine-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-chloropyrazine-2-carboxylic acid
CAS:Formula:C5H3ClN2O2Purity:97%Color and Shape:SolidMolecular weight:158.5425Ref: IN-DA003JBK
1kgTo inquire5kgTo inquire250mg27.00€1g42.00€5g75.00€10g132.00€25g196.00€50g302.00€100g518.00€3-Chloropyrazine-2-carboxylic acid
CAS:3-Chloropyrazine-2-carboxylic acidPurity:96%Color and Shape:SolidMolecular weight:158.54g/mol3-Chloro-2-pyrazine-carboxylic acid
CAS:3-Chloro-2-pyrazinecarboxylic acid is a nucleophilic compound that is synthetically produced and has antimicrobial properties. It is an active component of the drug 3,4 dichloro-2-pyrazinecarboxylic acid (DCP). This agent binds to the chloride ion in bacterial cells, which inactivates the enzyme adenosine triphosphatase that is essential for maintaining cellular homeostasis. 3-Chloro-2-pyrazinecarboxylic acid has been shown to be active against a number of Gram positive and Gram negative bacteria, including Staphylococcus epidermidis, Streptococcus pneumoniae, and Pseudomonas aeruginosa. It also has antibacterial activity against mycobacteria such as Mycobacterium tuberculosis and Mycobacterium avium complex.Formula:C5H3ClN2O2Purity:Min. 95%Color and Shape:Off-White To Light Brown SolidMolecular weight:158.54 g/mol3-Chloro-2-pyrazine-carboxylic acid
CAS:Formula:C5H3ClN2O2Purity:95%Color and Shape:SolidMolecular weight:158.54




