CAS 274-26-0
:1,3-Benzoxathiole
Description:
1,3-Benzoxathiole is a heterocyclic compound characterized by a fused benzene and oxathiole ring system. It features a five-membered ring containing sulfur and oxygen, which contributes to its unique chemical properties. The compound is typically a pale yellow to brown solid and is known for its aromatic nature, which can influence its reactivity and stability. 1,3-Benzoxathiole exhibits moderate solubility in organic solvents, making it useful in various chemical applications. Its structure allows for potential interactions with biological systems, leading to interest in its pharmacological properties. The presence of the sulfur atom can also impart distinctive electronic characteristics, affecting its behavior in chemical reactions. Additionally, derivatives of 1,3-benzoxathiole may exhibit varied biological activities, making it a subject of research in medicinal chemistry. Safety data indicates that, like many sulfur-containing compounds, it should be handled with care due to potential toxicity and reactivity. Overall, 1,3-benzoxathiole is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H6OS
InChI:InChI=1S/C7H6OS/c1-2-4-7-6(3-1)8-5-9-7/h1-4H,5H2
InChI key:AIUOUEPKBRDPLG-UHFFFAOYSA-N
SMILES:C1OC2=CC=CC=C2S1
Synonyms:- 1,3-Benzoxathiol
- 1-Oxa-3-thiaindan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

