CAS 274-82-8

[1,2,4]triazolo[4,3-a]pyrazine

Description:

[1,2,4]Triazolo[4,3-a]pyrazine is a heterocyclic compound characterized by a fused triazole and pyrazine ring system. It features a five-membered triazole ring and a six-membered pyrazine ring, contributing to its unique chemical properties. This compound is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the rings enhances its ability to participate in hydrogen bonding and coordination with metal ions. Additionally, [1,2,4]triazolo[4,3-a]pyrazine can exhibit various reactivity patterns, including electrophilic and nucleophilic substitutions, due to the electron-rich nature of the triazole moiety. Its derivatives may possess diverse biological activities, including antimicrobial and antitumor properties, making it a subject of research in pharmacology. Overall, [1,2,4]triazolo[4,3-a]pyrazine is a versatile compound with significant implications in both synthetic and medicinal chemistry.

Formula: C₅H₄N₄

InChI: InChI=1/C5H4N4/c1-2-9-4-7-8-5(9)3-6-1/h1-4H

SMILES: c1cn2cnnc2cn1

Synonyms:

• s-Triazolo[4,3-a]pyrazine
• 1,4-Triazolo[4,3-a]pyrazine
• [1,2,4]Triazolo[3,4-A]Pyrazine
• s-Triazolo<4,3-a>pyrazin
• 1,2,4-triazolo[4,3-a]pyrazine
• [1,2,4]Triazolo[4,3-a]pyrazine ,98.5%

[1,2,4]TRIAZOLO[4,3-A]PYRAZINE

CAS: 274-82-8

Formula: C₅H₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 120.1121

Ref: IN-DA003DB5

[1,2,4]Triazolo[4,3-a]pyrazine

CAS: 274-82-8

[1,2,4]Triazolo[4,3-a]pyrazine

Purity: 95%

Molecular weight: 120.11g/mol

Ref: 54-OR90143

[1,2,4]TRIAZOLO[4,3-A]PYRAZINE

CAS: 274-82-8

Formula: C₅H₄N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 120.115

Ref: 10-F305565