
CAS 2740-93-4
:N-Methyl-N′-(4-methylphenyl)thiourea
Description:
N-Methyl-N′-(4-methylphenyl)thiourea, with the CAS number 2740-93-4, is an organic compound that belongs to the class of thioureas. It features a thiourea functional group, characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) and a sulfur atom (S). This compound is typically a white to off-white solid and is soluble in polar organic solvents. Its structure includes a methyl group attached to one nitrogen atom and a para-methylphenyl group attached to the other nitrogen, which contributes to its unique chemical properties. N-Methyl-N′-(4-methylphenyl)thiourea is often studied for its potential applications in various fields, including medicinal chemistry and materials science, due to its ability to form coordination complexes and its reactivity in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in pharmacological research. As with many thioureas, it is important to handle this compound with care, as it may pose health risks if not managed properly.
Formula:C9H12N2S
InChI:InChI=1S/C9H12N2S/c1-7-3-5-8(6-4-7)11-9(12)10-2/h3-6H,1-2H3,(H2,10,11,12)
InChI key:InChIKey=IIMGWZIVKIMTGU-UHFFFAOYSA-N
SMILES:N(C(NC)=S)C1=CC=C(C)C=C1
Synonyms:- Urea, 1-methyl-2-thio-3-p-tolyl-
- Thiourea, N-methyl-N′-(4-methylphenyl)-
- 1-Methyl-3-p-tolylthiocarbamide
- N-Methyl-N′-(4-methylphenyl)thiourea
- 1-Methyl-3-(p-tolyl)thiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.