CAS 2741-14-2

3-benzyl-1,1-dimethylthiourea

Description:

3-Benzyl-1,1-dimethylthiourea is an organic compound characterized by the presence of a thiourea functional group, which consists of a carbonyl group (C=O) bonded to a sulfur atom (S). This compound features a benzyl group, which is a phenyl ring (a six-membered carbon ring with alternating double bonds) attached to a methylene (-CH2-) group, contributing to its aromatic properties. The two methyl groups attached to the nitrogen atoms in the thiourea structure enhance its steric bulk and influence its reactivity. 3-Benzyl-1,1-dimethylthiourea is typically used in various chemical syntheses and may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility characteristics can vary, often being soluble in organic solvents while having limited solubility in water. The compound's stability and reactivity can be influenced by the presence of the benzyl group, which can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Overall, this compound serves as a versatile building block in organic synthesis and research applications.

Formula: C₁₀H₁₄N₂S

InChI: InChI=1/C10H14N2S/c1-12(2)10(13)11-8-9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,11,13)

SMILES: CN(C)C(=NCc1ccccc1)S

Synonyms:

• thiourea, N,N-dimethyl-N'-(phenylmethyl)-
• 3-Benzyl-1,1-dimethylthiourea

1-benzyl-3,3-dimethylthiourea

Controlled Product

CAS: 2741-14-2

Applications 1-benzyl-3,3-dimethylthiourea (cas# 2741-14-2) is a useful research chemical.

Formula: C₁₀H₁₄N₂S

Color and Shape: Neat

Molecular weight: 194.3

Ref: TR-B537000

1-Benzyl-3,3-dimethylthiourea

CAS: 2741-14-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄N₂S

Purity: Min. 95%

Molecular weight: 194.3 g/mol

Ref: 3D-CAA74114