CymitQuimica logo

CAS 2741-38-0

:

Allyldiphenylphosphine

Description:
Allyldiphenylphosphine is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two phenyl groups and an allyl group. Its molecular structure features a phosphorus atom at the center, which is trivalent, meaning it forms three bonds, two of which are with phenyl rings and one with an allyl group. This compound is typically a colorless to pale yellow liquid and is known for its role as a ligand in coordination chemistry, particularly in catalysis and organic synthesis. Allyldiphenylphosphine exhibits moderate stability under standard conditions but can undergo oxidation or hydrolysis when exposed to moisture or air. It is soluble in organic solvents, making it useful in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, allyldiphenylphosphine is valued in synthetic chemistry for its reactivity and ability to form complexes with transition metals.
Formula:C15H15P
InChI:InChI=1/C15H15P/c1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h2-12H,1,13H2
InChI key:PDDYFPPQDKRJTK-UHFFFAOYSA-N
SMILES:C=CCP(c1ccccc1)c1ccccc1
Synonyms:
  • Allyl(diphenyl)phosphine
  • Phosphine, Diphenyl-2-Propen-1-Yl-
  • Diphenyl(Prop-2-En-1-Yl)Phosphane
Found 3 products.