CAS 27418-59-3

3-[(4-methylphenyl)amino]propanoate

Description:

3-[(4-Methylphenyl)amino]propanoate, with the CAS number 27418-59-3, is an organic compound characterized by its propanoate structure, which includes an amino group attached to a phenyl ring that has a methyl substituent. This compound typically exhibits properties associated with both amines and carboxylic acids, such as potential solubility in polar solvents due to the presence of the carboxylate group. The aromatic ring contributes to its stability and may influence its reactivity and interaction with biological systems. The presence of the methyl group on the phenyl ring can affect the compound's steric and electronic properties, potentially enhancing its lipophilicity. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthesis. As with many organic compounds, its behavior can be influenced by environmental factors such as pH and temperature, which can affect its ionization state and solubility.

Formula: C₁₀H₁₂NO₂

InChI: InChI=1/C10H13NO2/c1-8-2-4-9(5-3-8)11-7-6-10(12)13/h2-5,11H,6-7H2,1H3,(H,12,13)/p-1

SMILES: Cc1ccc(cc1)NCCC(=O)[O-]

3-[(4-Methylphenyl)amino]propanoic acid

CAS: 27418-59-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-CBA41859