CAS 27421-91-6

N-cyclohexyl-2-phenylhydrazinecarbothioamide

Description:

N-cyclohexyl-2-phenylhydrazinecarbothioamide is an organic compound characterized by its hydrazine and thiourea functional groups. It features a cyclohexyl group attached to a hydrazine moiety, which is further connected to a phenyl group and a carbothioamide functional group. This compound typically exhibits properties associated with hydrazines, such as being a potential reducing agent and having applications in organic synthesis. Its structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The presence of the thiourea group may impart additional reactivity, particularly in forming metal complexes or engaging in biological interactions. As with many hydrazine derivatives, safety precautions are necessary due to potential toxicity and reactivity. The compound's solubility, stability, and specific reactivity can vary based on environmental conditions such as temperature and pH. Overall, N-cyclohexyl-2-phenylhydrazinecarbothioamide is of interest in both synthetic chemistry and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₃H₁₉N₃S

InChI: InChI=1/C13H19N3S/c17-13(14-11-7-3-1-4-8-11)16-15-12-9-5-2-6-10-12/h2,5-6,9-11,15H,1,3-4,7-8H2,(H2,14,16,17)

SMILES: C1CCC(CC1)N=C(NNc1ccccc1)S

4-Cyclohexyl-1-phenylthiosemicarbazide

CAS: 27421-91-6

4-Cyclohexyl-1-phenylthiosemicarbazide

Purity: ≥98%

Molecular weight: 249.38g/mol

Ref: 54-BUP00292

4-Cyclohexyl-1-phenylthiosemicarbazide

CAS: 27421-91-6

4-Cyclohexyl-1-phenylthiosemicarbazide is employed as an intermediate.

Formula: C₁₃H₁₉N₃S

Purity: 99.29%

Color and Shape: Solid

Molecular weight: 249.38

Ref: TM-T1727