CAS 27423-80-9

2-[3-(Trifluoromethyl)phenyl]-1H-imidazole

Description:

2-[3-(Trifluoromethyl)phenyl]-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a trifluoromethyl group (-CF3) attached to a phenyl ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, particularly in the development of antifungal or antimicrobial agents, due to the imidazole moiety's known biological activity. Additionally, the trifluoromethyl group can enhance metabolic stability and alter the compound's interaction with biological targets. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-[3-(Trifluoromethyl)phenyl]-1H-imidazole is a compound of interest in medicinal chemistry and materials science, warranting further investigation into its properties and applications.

Formula: C₁₀H₇F₃N₂

InChI: InChI=1S/C10H7F3N2/c11-10(12,13)8-3-1-2-7(6-8)9-14-4-5-15-9/h1-6H,(H,14,15)

InChI key: InChIKey=FKNKITNWTIFPFX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=CC1)C=2NC=CN2

Synonyms:

• 2-[3-(Trifluoromethyl)phenyl]-1H-imidazole
• Imidazole, 2-(α,α,α-trifluoro-m-tolyl)-
• 1H-Imidazole, 2-[3-(trifluoromethyl)phenyl]-

2-[3-(Trifluoromethyl)phenyl]-1H-imidazole

CAS: 27423-80-9

Versatile small molecule scaffold

Formula: C₁₀H₇F₃N₂

Purity: Min. 95%

Molecular weight: 212.17 g/mol

Ref: 3D-CBA42380