CAS 27423-82-1: 4,5-Dihydro-2-(3-methylphenyl)-1H-imidazole
Description:4,5-Dihydro-2-(3-methylphenyl)-1H-imidazole, with the CAS number 27423-82-1, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a 3-methylphenyl group attached to the imidazole ring, contributing to its unique chemical properties and potential biological activity. The presence of the dihydro group indicates that the compound has undergone partial hydrogenation, affecting its reactivity and stability. Typically, imidazole derivatives are known for their diverse applications in pharmaceuticals, agrochemicals, and as ligands in coordination chemistry. The compound may exhibit various physical properties such as solubility in organic solvents and specific melting or boiling points, which are influenced by its molecular structure. Additionally, its potential interactions with biological systems make it a subject of interest in medicinal chemistry, where it may serve as a scaffold for drug development. Overall, 4,5-Dihydro-2-(3-methylphenyl)-1H-imidazole represents a significant class of compounds with varied applications in chemical research and industry.
Formula:C10H12N2
InChI:InChI=1S/C10H12N2/c1-8-3-2-4-9(7-8)10-11-5-6-12-10/h2-4,7H,5-6H2,1H3,(H,11,12)
InChI key:InChIKey=FAZYMPYKTJYGNR-UHFFFAOYSA-N
SMILES:N1=C(NCC1)C=2C=CC=C(C2)C
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(3-Methylphenyl)-4,5-dihydro-1H-imidazole REF: 3D-CBA42382CAS: 27423-82-1 | Min. 95% | To inquire | Tue 27 May 25 |
![]() | 2-(3-Methylphenyl)-4,5-dihydro-1h-imidazole REF: 10-F660130CAS: 27423-82-1 | 95% | - - - | Discontinued product |

2-(3-Methylphenyl)-4,5-dihydro-1H-imidazole
Ref: 3D-CBA42382
1g | 918.00 € | ||
100mg | 427.00 € |

2-(3-Methylphenyl)-4,5-dihydro-1h-imidazole
Ref: 10-F660130
1g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |